C33H39ClN4O — CID 53245994
6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(1-methylimidazol-2-yl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene chloride (PubChem CID 53245994) has the molecular formula C33H39ClN4O and a molecular weight of 543.16 g/mol. Its IUPAC name is 6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(1-methylimidazol-2-yl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene chloride.
| Compound Name | 6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(1-methylimidazol-2-yl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene chloride |
|---|---|
| PubChem CID | 53245994 |
| Molecular Formula | C33H39ClN4O |
| Molecular Weight | 543.16 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(1-methylimidazol-2-yl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene chloride |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(c1nccn1C)=c1cc2c(cc1O3)=[N+](CC)C(C)(C)C=C2C.[Cl-] |
| InChI | InChI=1S/C33H39N4O.ClH/c1-10-36-26-16-28-24(14-22(26)20(3)18-32(36,5)6)30(31-34-12-13-35(31)9)25-15-23-21(4)19-33(7,8)37(11-2)27(23)17-29(25)38-28;/h12-19H,10-11H2,1-9H3;1H/q+1;/p-1 |
| InChIKey | IGTHCWHPJVWVLI-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 33.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|