C19H15N5 — CID 53246041
8-methyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 53246041) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 8-methyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-methyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 53246041 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 8-methyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethynyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cccn2nc(C#Cc3nc(-c4ccccc4)cn3C)nc12 |
| InChI | InChI=1S/C19H15N5/c1-14-7-6-12-24-19(14)21-17(22-24)10-11-18-20-16(13-23(18)2)15-8-4-3-5-9-15/h3-9,12-13H,1-2H3 |
| InChIKey | OBMNHNRLRQIBJF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|