C27H31N5O3S — CID 53246234
methyl 6-[(3R,5S)-3,5-dimethyl-4-[2-oxo-2-(2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl)ethyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 53246234) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is methyl 6-[(3R,5S)-3,5-dimethyl-4-[2-oxo-2-(2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl)ethyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(3R,5S)-3,5-dimethyl-4-[2-oxo-2-(2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl)ethyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 53246234 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | methyl 6-[(3R,5S)-3,5-dimethyl-4-[2-oxo-2-(2-phenyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl)ethyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2C[C@@H](C)N(CC(=O)N3CCc4nc(-c5ccccc5)sc4C3)[C@@H](C)C2)nc1 |
| InChI | InChI=1S/C27H31N5O3S/c1-18-14-31(24-10-9-21(13-28-24)27(34)35-3)15-19(2)32(18)17-25(33)30-12-11-22-23(16-30)36-26(29-22)20-7-5-4-6-8-20/h4-10,13,18-19H,11-12,14-17H2,1-3H3/t18-,19+ |
| InChIKey | RJEUNCHUCXIOFI-KDURUIRLSA-N |
| XLogP | 3.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |