C29H26FN7O2 — CID 53247039
2-fluoro-N-(4-hydroxycyclohexyl)-4-[3-(1-quinolin-6-ylcyclopropyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]benzamide (PubChem CID 53247039) has the molecular formula C29H26FN7O2 and a molecular weight of 523.57 g/mol. Its IUPAC name is 2-fluoro-N-(4-hydroxycyclohexyl)-4-[3-(1-quinolin-6-ylcyclopropyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]benzamide.
| Compound Name | 2-fluoro-N-(4-hydroxycyclohexyl)-4-[3-(1-quinolin-6-ylcyclopropyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]benzamide |
|---|---|
| PubChem CID | 53247039 |
| Molecular Formula | C29H26FN7O2 |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 2-fluoro-N-(4-hydroxycyclohexyl)-4-[3-(1-quinolin-6-ylcyclopropyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-6-yl]benzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1ccc(-c2cnc3nnc(C4(c5ccc6ncccc6c5)CC4)n3n2)cc1F |
| InChI | InChI=1S/C29H26FN7O2/c30-23-15-18(3-9-22(23)26(39)33-20-5-7-21(38)8-6-20)25-16-32-28-35-34-27(37(28)36-25)29(11-12-29)19-4-10-24-17(14-19)2-1-13-31-24/h1-4,9-10,13-16,20-21,38H,5-8,11-12H2,(H,33,39) |
| InChIKey | ARUGGLRDKZMNKZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |