C18H18N4O3 — CID 53247319
(3S,4R)-3,4-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide (PubChem CID 53247319) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide.
| Compound Name | (3S,4R)-3,4-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
|---|---|
| PubChem CID | 53247319 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3S,4R)-3,4-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3cc4n(c3c2)[C@H](C)[C@H](C)NC4=O)no1 |
| InChI | InChI=1S/C18H18N4O3/c1-9-6-16(21-25-9)20-17(23)13-5-4-12-7-15-18(24)19-10(2)11(3)22(15)14(12)8-13/h4-8,10-11H,1-3H3,(H,19,24)(H,20,21,23)/t10-,11+/m0/s1 |
| InChIKey | AMQAOXDPHJIPPA-WDEREUQCSA-N |
| XLogP | 2.88 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |