C19H14F3N5O — CID 53247379
4-(5-methoxy-1-methylindol-3-yl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 53247379) has the molecular formula C19H14F3N5O and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-(5-methoxy-1-methylindol-3-yl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 4-(5-methoxy-1-methylindol-3-yl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 53247379 |
| Molecular Formula | C19H14F3N5O |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-(5-methoxy-1-methylindol-3-yl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COc1ccc2c(c1)c(-c1cc3c(ncc4cnc(C(F)(F)F)n43)[nH]1)cn2C |
| InChI | InChI=1S/C19H14F3N5O/c1-26-9-13(12-5-11(28-2)3-4-15(12)26)14-6-16-17(25-14)23-7-10-8-24-18(27(10)16)19(20,21)22/h3-9,25H,1-2H3 |
| InChIKey | OWOQSTULZOWOKK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |