C20H20N5O5P — CID 53247621
[11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl dihydrogen phosphate (PubChem CID 53247621) has the molecular formula C20H20N5O5P and a molecular weight of 441.38 g/mol. Its IUPAC name is [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl dihydrogen phosphate.
| Compound Name | [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 53247621 |
| Molecular Formula | C20H20N5O5P |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]methyl dihydrogen phosphate |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1COP(=O)(O)O)cnn4C)cn2C |
| InChI | InChI=1S/C20H20N5O5P/c1-23-10-16(14-6-13(29-3)4-5-17(14)23)18-7-15-19-12(9-22-24(19)2)8-21-20(15)25(18)11-30-31(26,27)28/h4-10H,11H2,1-3H3,(H2,26,27,28) |
| InChIKey | YXONAHOKEUVWBW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|