C23H23Cl2F3N2O — CID 53247697
N-[1-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]cyclopropanecarboxamide (PubChem CID 53247697) has the molecular formula C23H23Cl2F3N2O and a molecular weight of 471.35 g/mol. Its IUPAC name is N-[1-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 53247697 |
| Molecular Formula | C23H23Cl2F3N2O |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | N-[1-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]ethyl]cyclopropanecarboxamide |
| SMILES | CC(NC(=O)C1CC1)c1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C23H23Cl2F3N2O/c1-14(29-21(31)16-2-3-16)15-4-6-20(7-5-15)30-9-8-22(13-30,23(26,27)28)17-10-18(24)12-19(25)11-17/h4-7,10-12,14,16H,2-3,8-9,13H2,1H3,(H,29,31) |
| InChIKey | RQRRJWCFJJAJFS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|