C9H8Br2O3 — CID 53247970
(1S,5R)-3,4-dibromo-6-(hydroxymethyl)-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one (PubChem CID 53247970) has the molecular formula C9H8Br2O3 and a molecular weight of 323.97 g/mol. Its IUPAC name is (1S,5R)-3,4-dibromo-6-(hydroxymethyl)-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one.
| Compound Name | (1S,5R)-3,4-dibromo-6-(hydroxymethyl)-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one |
|---|---|
| PubChem CID | 53247970 |
| Molecular Formula | C9H8Br2O3 |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | (1S,5R)-3,4-dibromo-6-(hydroxymethyl)-5-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-2-one |
| SMILES | C[C@@]12O[C@@H](C=C1CO)C(=O)C(Br)=C2Br |
| InChI | InChI=1S/C9H8Br2O3/c1-9-4(3-12)2-5(14-9)7(13)6(10)8(9)11/h2,5,12H,3H2,1H3/t5-,9+/m0/s1 |
| InChIKey | OJTQRRMDXAFDNP-SSDLBLMSSA-N |
| XLogP | 1.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|