C16H24O3 — CID 53248001
(1S,3aS,9S,9aS,9bR)-3a-methoxy-1,9,9a-trimethyl-2,4,5,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-7-one (PubChem CID 53248001) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1S,3aS,9S,9aS,9bR)-3a-methoxy-1,9,9a-trimethyl-2,4,5,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-7-one.
| Compound Name | (1S,3aS,9S,9aS,9bR)-3a-methoxy-1,9,9a-trimethyl-2,4,5,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-7-one |
|---|---|
| PubChem CID | 53248001 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1S,3aS,9S,9aS,9bR)-3a-methoxy-1,9,9a-trimethyl-2,4,5,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-7-one |
| SMILES | CO[C@]12CCC3=CC(=O)C[C@H](C)[C@@]3(C)[C@H]1[C@H](C)CO2 |
| InChI | InChI=1S/C16H24O3/c1-10-9-19-16(18-4)6-5-12-8-13(17)7-11(2)15(12,3)14(10)16/h8,10-11,14H,5-7,9H2,1-4H3/t10-,11+,14-,15-,16+/m1/s1 |
| InChIKey | HKQNDBGWZCGOEP-MOEWQIFZSA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |