About 2-Methyl-1,3-oxazole-4-carbonitrile
2-Methyl-1,3-oxazole-4-carbonitrile (PubChem CID 5324808) has the molecular formula C5H4N2O
and a molecular weight of 108.10 g/mol. Its IUPAC name is 2-methyl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-Methyl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 5324808 |
| Molecular Formula | C5H4N2O |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.03 |
| IUPAC Name | 2-methyl-1,3-oxazole-4-carbonitrile |
| SMILES | CC1=NC(=CO1)C#N |
| InChI | InChI=1S/C5H4N2O/c1-4-7-5(2-6)3-8-4/h3H,1H3 |
| InChIKey | NVFTYSPOXDAKMQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 126 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-Methyl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methyl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-Methyl-1,3-oxazole-4-carbonitrile (CID 5324808) is 2-methyl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-Methyl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-Methyl-1,3-oxazole-4-carbonitrile is CC1=NC(=CO1)C#N.
What is the InChIKey of 2-Methyl-1,3-oxazole-4-carbonitrile?
The InChIKey is NVFTYSPOXDAKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O/c1-4-7-5(2-6)3-8-4/h3H,1H3.
What are the key properties of 2-Methyl-1,3-oxazole-4-carbonitrile?
2-Methyl-1,3-oxazole-4-carbonitrile has a molecular weight of 108.10 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methyl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 5324808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).