C29H35ClN4OS — CID 53248129
(2S)-1-[4-[4-[3-(2-cyclohexylethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]pyrrolidine-2-carboximidamide;hydrochloride (PubChem CID 53248129) has the molecular formula C29H35ClN4OS and a molecular weight of 523.15 g/mol. Its IUPAC name is (2S)-1-[4-[4-[3-(2-cyclohexylethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]pyrrolidine-2-carboximidamide;hydrochloride.
| Compound Name | (2S)-1-[4-[4-[3-(2-cyclohexylethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]pyrrolidine-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 53248129 |
| Molecular Formula | C29H35ClN4OS |
| Molecular Weight | 523.15 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (2S)-1-[4-[4-[3-(2-cyclohexylethyl)phenyl]-1,3-thiazol-2-yl]benzoyl]pyrrolidine-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)[C@@H]1CCCN1C(=O)c1ccc(-c2nc(-c3cccc(CCC4CCCCC4)c3)cs2)cc1 |
| InChI | InChI=1S/C29H34N4OS.ClH/c30-27(31)26-10-5-17-33(26)29(34)23-15-13-22(14-16-23)28-32-25(19-35-28)24-9-4-8-21(18-24)12-11-20-6-2-1-3-7-20;/h4,8-9,13-16,18-20,26H,1-3,5-7,10-12,17H2,(H3,30,31);1H/t26-;/m0./s1 |
| InChIKey | QZYNKVNLISRZJT-SNYZSRNZSA-N |
| XLogP | 6.95 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.15 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|