About (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one
(2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one (PubChem CID 5324820) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one.
Molecular Properties
| Compound Name | (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one |
| PubChem CID | 5324820 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one |
| SMILES | CC1=CC(=O)C[C@](C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C11H18O2/c1-8-6-9(12)7-11(5,13-8)10(2,3)4/h6H,7H2,1-5H3/t11-/m1/s1 |
| InChIKey | UQRIPPKHEFWKDK-LLVKDONJSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one?
The IUPAC name of (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one (CID 5324820) is (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one.
What is the SMILES notation for (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one?
The canonical SMILES for (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one is CC1=CC(=O)C[C@](C)(C(C)(C)C)O1.
What is the InChIKey of (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one?
The InChIKey is UQRIPPKHEFWKDK-LLVKDONJSA-N. The full InChI is InChI=1S/C11H18O2/c1-8-6-9(12)7-11(5,13-8)10(2,3)4/h6H,7H2,1-5H3/t11-/m1/s1.
What are the key properties of (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one?
(2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one has a molecular weight of 182.26 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-tert-butyl-2,6-dimethyl-3H-pyran-4-one is sourced from PubChem (CID 5324820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).