C22H35IO4 — CID 53248474
[(E,6S)-6-[(4S,5R,6R)-6-(2-iodoethynyl)-2,2,5-trimethyl-1,3-dioxan-4-yl]-5-methylhept-4-enyl] 2,2-dimethylpropanoate (PubChem CID 53248474) has the molecular formula C22H35IO4 and a molecular weight of 490.42 g/mol. Its IUPAC name is [(E,6S)-6-[(4S,5R,6R)-6-(2-iodoethynyl)-2,2,5-trimethyl-1,3-dioxan-4-yl]-5-methylhept-4-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,6S)-6-[(4S,5R,6R)-6-(2-iodoethynyl)-2,2,5-trimethyl-1,3-dioxan-4-yl]-5-methylhept-4-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53248474 |
| Molecular Formula | C22H35IO4 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [(E,6S)-6-[(4S,5R,6R)-6-(2-iodoethynyl)-2,2,5-trimethyl-1,3-dioxan-4-yl]-5-methylhept-4-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\CCCOC(=O)C(C)(C)C)[C@H](C)[C@@H]1OC(C)(C)O[C@@H](C#CI)[C@@H]1C |
| InChI | InChI=1S/C22H35IO4/c1-15(11-9-10-14-25-20(24)21(4,5)6)16(2)19-17(3)18(12-13-23)26-22(7,8)27-19/h11,16-19H,9-10,14H2,1-8H3/b15-11+/t16-,17-,18-,19-/m0/s1 |
| InChIKey | PLPSUYMWSXWINF-AYZYTREOSA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|