C16H28O4 — CID 53248478
(2R)-1-[(4S,6S)-6-[(2R)-2-hydroxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-ol (PubChem CID 53248478) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R)-1-[(4S,6S)-6-[(2R)-2-hydroxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-ol.
| Compound Name | (2R)-1-[(4S,6S)-6-[(2R)-2-hydroxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 53248478 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2R)-1-[(4S,6S)-6-[(2R)-2-hydroxypent-4-enyl]-2,2-dimethyl-1,3-dioxan-4-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@@H](O)C[C@H]1C[C@H](C[C@H](O)CC=C)OC(C)(C)O1 |
| InChI | InChI=1S/C16H28O4/c1-5-7-12(17)9-14-11-15(10-13(18)8-6-2)20-16(3,4)19-14/h5-6,12-15,17-18H,1-2,7-11H2,3-4H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | SRGWBOPNLZAACK-KBXIAJHMSA-N |
| XLogP | 2.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|