C12H23NO3 — CID 53248526
tert-butyl N-[(4R)-4-hydroxyhept-6-enyl]carbamate (PubChem CID 53248526) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-hydroxyhept-6-enyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-hydroxyhept-6-enyl]carbamate |
|---|---|
| PubChem CID | 53248526 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl N-[(4R)-4-hydroxyhept-6-enyl]carbamate |
| SMILES | C=CC[C@H](O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-5-7-10(14)8-6-9-13-11(15)16-12(2,3)4/h5,10,14H,1,6-9H2,2-4H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | HVBSLDMKCGDAKB-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|