C8H8ClF3N2O2S — CID 53248545
N-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanesulfonamide (PubChem CID 53248545) has the molecular formula C8H8ClF3N2O2S and a molecular weight of 288.68 g/mol. Its IUPAC name is N-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanesulfonamide.
| Compound Name | N-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 53248545 |
| Molecular Formula | C8H8ClF3N2O2S |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | N-[6-chloro-5-(trifluoromethyl)-2-pyridinyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C8H8ClF3N2O2S/c1-2-17(15,16)14-6-4-3-5(7(9)13-6)8(10,11)12/h3-4H,2H2,1H3,(H,13,14) |
| InChIKey | SEOIPOFKXOUYFP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|