C26H29N4O9P — CID 53248633
2-[[(2S,11S)-12-oxo-11-[[(E)-3-(4-phosphonooxyphenyl)but-2-enoyl]amino]-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]ethyl carbamate (PubChem CID 53248633) has the molecular formula C26H29N4O9P and a molecular weight of 572.51 g/mol. Its IUPAC name is 2-[[(2S,11S)-12-oxo-11-[[(E)-3-(4-phosphonooxyphenyl)but-2-enoyl]amino]-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[(2S,11S)-12-oxo-11-[[(E)-3-(4-phosphonooxyphenyl)but-2-enoyl]amino]-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 53248633 |
| Molecular Formula | C26H29N4O9P |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 2-[[(2S,11S)-12-oxo-11-[[(E)-3-(4-phosphonooxyphenyl)but-2-enoyl]amino]-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]ethyl carbamate |
| SMILES | C/C(=C\C(=O)N[C@H]1CCc2cccc3c2N(C1=O)[C@H](C(=O)NCCOC(N)=O)C3)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C26H29N4O9P/c1-15(16-5-8-19(9-6-16)39-40(35,36)37)13-22(31)29-20-10-7-17-3-2-4-18-14-21(30(23(17)18)25(20)33)24(32)28-11-12-38-26(27)34/h2-6,8-9,13,20-21H,7,10-12,14H2,1H3,(H2,27,34)(H,28,32)(H,29,31)(H2,35,36,37)/b15-13+/t20-,21-/m0/s1 |
| InChIKey | RWFRVPZUGDMQKR-HHQHQPNISA-N |
| XLogP | 1.16 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|