C27H34FN3O7 — CID 53248672
7-[4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid (PubChem CID 53248672) has the molecular formula C27H34FN3O7 and a molecular weight of 531.58 g/mol. Its IUPAC name is 7-[4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid.
| Compound Name | 7-[4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid |
|---|---|
| PubChem CID | 53248672 |
| Molecular Formula | C27H34FN3O7 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 7-[4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C1CCc2ccc(OCCCCN3CCN(c4ccccc4OCCF)CC3)cc2N1 |
| InChI | InChI=1S/C25H32FN3O3.C2H2O4/c26-11-18-32-24-6-2-1-5-23(24)29-15-13-28(14-16-29)12-3-4-17-31-21-9-7-20-8-10-25(30)27-22(20)19-21;3-1(4)2(5)6/h1-2,5-7,9,19H,3-4,8,10-18H2,(H,27,30);(H,3,4)(H,5,6) |
| InChIKey | YLJIJIFCXUKGQF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|