C7H10O2 — CID 5324907
(4R,5R)-4,5-dimethyl-3-methylideneoxolan-2-one (PubChem CID 5324907) has the molecular formula C7H10O2 and a molecular weight of 126.16 g/mol. Its IUPAC name is (4R,5R)-4,5-dimethyl-3-methylideneoxolan-2-one.
| Compound Name | (4R,5R)-4,5-dimethyl-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 5324907 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (4R,5R)-4,5-dimethyl-3-methylideneoxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C7H10O2/c1-4-5(2)7(8)9-6(4)3/h4,6H,2H2,1,3H3/t4-,6-/m1/s1 |
| InChIKey | GWSGIIGWNQXFIJ-INEUFUBQSA-N |
| XLogP | 1.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|