C26H33N3O7 — CID 53249133
7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid (PubChem CID 53249133) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is 7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid.
| Compound Name | 7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid |
|---|---|
| PubChem CID | 53249133 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 7-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;oxalic acid |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc3c(c2)NC(=O)CC3)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H31N3O3.C2H2O4/c1-29-23-7-3-2-6-22(23)27-15-13-26(14-16-27)12-4-5-17-30-20-10-8-19-9-11-24(28)25-21(19)18-20;3-1(4)2(5)6/h2-3,6-8,10,18H,4-5,9,11-17H2,1H3,(H,25,28);(H,3,4)(H,5,6) |
| InChIKey | XMAQYICGLYMYIR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|