About 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one
5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one (PubChem CID 53249142) has the molecular formula C21H14N2O4
and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one |
| PubChem CID | 53249142 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1-c1cc2c(=O)oc3ccccc3c2o1 |
| InChI | InChI=1S/C21H14N2O4/c1-12-18(20(24)23(22-12)13-7-3-2-4-8-13)17-11-15-19(26-17)14-9-5-6-10-16(14)27-21(15)25/h2-11,22H,1H3 |
| InChIKey | PJAUHKBMHUGRFK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one?
The IUPAC name of 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one (CID 53249142) is 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one?
The canonical SMILES for 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one is Cc1[nH]n(-c2ccccc2)c(=O)c1-c1cc2c(=O)oc3ccccc3c2o1.
What is the InChIKey of 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one?
The InChIKey is PJAUHKBMHUGRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O4/c1-12-18(20(24)23(22-12)13-7-3-2-4-8-13)17-11-15-19(26-17)14-9-5-6-10-16(14)27-21(15)25/h2-11,22H,1H3.
What are the key properties of 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one?
5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one has a molecular weight of 358.35 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(4-oxofuro[3,2-c]chromen-2-yl)-2-phenyl-1H-pyrazol-3-one is sourced from PubChem (CID 53249142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).