About 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole
2-methyl-1-prop-2-enyl-4,5-dihydroimidazole (PubChem CID 5324920) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole |
| PubChem CID | 5324920 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole |
| SMILES | C=CCN1CCN=C1C |
| InChI | InChI=1S/C7H12N2/c1-3-5-9-6-4-8-7(9)2/h3H,1,4-6H2,2H3 |
| InChIKey | HWJSHQMGNQGVJB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole?
The IUPAC name of 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole (CID 5324920) is 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole.
What is the SMILES notation for 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole?
The canonical SMILES for 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole is C=CCN1CCN=C1C.
What is the InChIKey of 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole?
The InChIKey is HWJSHQMGNQGVJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-5-9-6-4-8-7(9)2/h3H,1,4-6H2,2H3.
What are the key properties of 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole?
2-methyl-1-prop-2-enyl-4,5-dihydroimidazole has a molecular weight of 124.19 g/mol, XLogP of 0.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-prop-2-enyl-4,5-dihydroimidazole is sourced from PubChem (CID 5324920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).