About [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol
[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol (PubChem CID 53249512) has the molecular formula C8H12S
and a molecular weight of 140.25 g/mol. Its IUPAC name is [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol.
Molecular Properties
| Compound Name | [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol |
| PubChem CID | 53249512 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol |
| SMILES | C[C@]1(CS)C=CC=CC1 |
| InChI | InChI=1S/C8H12S/c1-8(7-9)5-3-2-4-6-8/h2-5,9H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | VGIBRAXLDUDYAY-QMMMGPOBSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol?
The IUPAC name of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol (CID 53249512) is [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol.
What is the SMILES notation for [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol?
The canonical SMILES for [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol is C[C@]1(CS)C=CC=CC1.
What is the InChIKey of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol?
The InChIKey is VGIBRAXLDUDYAY-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H12S/c1-8(7-9)5-3-2-4-6-8/h2-5,9H,6-7H2,1H3/t8-/m0/s1.
What are the key properties of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol?
[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol has a molecular weight of 140.25 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanethiol is sourced from PubChem (CID 53249512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).