About CID 53249579
CID 53249579 (PubChem CID 53249579) has the molecular formula C20H15NNaO7
and a molecular weight of 404.33 g/mol.
Molecular Properties
| Compound Name | CID 53249579 |
| PubChem CID | 53249579 |
| Molecular Formula | C20H15NNaO7 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(OCC(O)COc2cccc3oc(C(=O)O)cc(=O)c23)cc1.[Na] |
| InChI | InChI=1S/C20H15NO7.Na/c21-9-12-4-6-14(7-5-12)26-10-13(22)11-27-16-2-1-3-17-19(16)15(23)8-18(28-17)20(24)25;/h1-8,13,22H,10-11H2,(H,24,25); |
| InChIKey | DQXGAYZAEOTJQJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 53249579 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53249579?
The IUPAC name of CID 53249579 (CID 53249579) is not available.
What is the SMILES notation for CID 53249579?
The canonical SMILES for CID 53249579 is N#Cc1ccc(OCC(O)COc2cccc3oc(C(=O)O)cc(=O)c23)cc1.[Na].
What is the InChIKey of CID 53249579?
The InChIKey is DQXGAYZAEOTJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO7.Na/c21-9-12-4-6-14(7-5-12)26-10-13(22)11-27-16-2-1-3-17-19(16)15(23)8-18(28-17)20(24)25;/h1-8,13,22H,10-11H2,(H,24,25);.
What are the key properties of CID 53249579?
CID 53249579 has a molecular weight of 404.33 g/mol, XLogP of 1.80, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53249579 is sourced from PubChem (CID 53249579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).