About 9-methylpurine-2,6,8-trione
9-methylpurine-2,6,8-trione (PubChem CID 53249617) has the molecular formula C6H4N4O3
and a molecular weight of 180.12 g/mol. Its IUPAC name is 9-methylpurine-2,6,8-trione.
Molecular Properties
| Compound Name | 9-methylpurine-2,6,8-trione |
| PubChem CID | 53249617 |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 9-methylpurine-2,6,8-trione |
| SMILES | CN1C(=O)N=C2C(=O)NC(=O)N=C21 |
| InChI | InChI=1S/C6H4N4O3/c1-10-3-2(7-6(10)13)4(11)9-5(12)8-3/h1H3,(H,9,11,12) |
| InChIKey | VILKVFMLOSXUPE-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methylpurine-2,6,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylpurine-2,6,8-trione?
The IUPAC name of 9-methylpurine-2,6,8-trione (CID 53249617) is 9-methylpurine-2,6,8-trione.
What is the SMILES notation for 9-methylpurine-2,6,8-trione?
The canonical SMILES for 9-methylpurine-2,6,8-trione is CN1C(=O)N=C2C(=O)NC(=O)N=C21.
What is the InChIKey of 9-methylpurine-2,6,8-trione?
The InChIKey is VILKVFMLOSXUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O3/c1-10-3-2(7-6(10)13)4(11)9-5(12)8-3/h1H3,(H,9,11,12).
What are the key properties of 9-methylpurine-2,6,8-trione?
9-methylpurine-2,6,8-trione has a molecular weight of 180.12 g/mol, XLogP of -0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylpurine-2,6,8-trione is sourced from PubChem (CID 53249617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).