About 2-ethynyl-1,3,4-trifluoro-5-methylbenzene
2-ethynyl-1,3,4-trifluoro-5-methylbenzene (PubChem CID 53249704) has the molecular formula C9H5F3
and a molecular weight of 170.13 g/mol. Its IUPAC name is 2-ethynyl-1,3,4-trifluoro-5-methylbenzene.
Molecular Properties
| Compound Name | 2-ethynyl-1,3,4-trifluoro-5-methylbenzene |
| PubChem CID | 53249704 |
| Molecular Formula | C9H5F3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2-ethynyl-1,3,4-trifluoro-5-methylbenzene |
| SMILES | C#Cc1c(F)cc(C)c(F)c1F |
| InChI | InChI=1S/C9H5F3/c1-3-6-7(10)4-5(2)8(11)9(6)12/h1,4H,2H3 |
| InChIKey | LJMGFGBRNZFHFF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-1,3,4-trifluoro-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-1,3,4-trifluoro-5-methylbenzene?
The IUPAC name of 2-ethynyl-1,3,4-trifluoro-5-methylbenzene (CID 53249704) is 2-ethynyl-1,3,4-trifluoro-5-methylbenzene.
What is the SMILES notation for 2-ethynyl-1,3,4-trifluoro-5-methylbenzene?
The canonical SMILES for 2-ethynyl-1,3,4-trifluoro-5-methylbenzene is C#Cc1c(F)cc(C)c(F)c1F.
What is the InChIKey of 2-ethynyl-1,3,4-trifluoro-5-methylbenzene?
The InChIKey is LJMGFGBRNZFHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3/c1-3-6-7(10)4-5(2)8(11)9(6)12/h1,4H,2H3.
What are the key properties of 2-ethynyl-1,3,4-trifluoro-5-methylbenzene?
2-ethynyl-1,3,4-trifluoro-5-methylbenzene has a molecular weight of 170.13 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-1,3,4-trifluoro-5-methylbenzene is sourced from PubChem (CID 53249704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).