About ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate
ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate (PubChem CID 53249839) has the molecular formula C10H9BrN2O2
and a molecular weight of 269.10 g/mol. Its IUPAC name is ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate |
| PubChem CID | 53249839 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1nc(Br)c2ccccn12 |
| InChI | InChI=1S/C10H9BrN2O2/c1-2-15-10(14)9-12-8(11)7-5-3-4-6-13(7)9/h3-6H,2H2,1H3 |
| InChIKey | IMZDSBVUTOUBSJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate?
The IUPAC name of ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate (CID 53249839) is ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate?
The canonical SMILES for ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate is CCOC(=O)c1nc(Br)c2ccccn12.
What is the InChIKey of ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate?
The InChIKey is IMZDSBVUTOUBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O2/c1-2-15-10(14)9-12-8(11)7-5-3-4-6-13(7)9/h3-6H,2H2,1H3.
What are the key properties of ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate?
ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate has a molecular weight of 269.10 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-bromoimidazo[1,5-a]pyridine-3-carboxylate is sourced from PubChem (CID 53249839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).