About N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate
N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate (PubChem CID 53249924) has the molecular formula C9H14F3N2O3-
and a molecular weight of 255.22 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate.
Molecular Properties
| Compound Name | N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
| PubChem CID | 53249924 |
| Molecular Formula | C9H14F3N2O3- |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)N(CCNC(=O)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C9H15F3N2O3/c1-8(2,3)14(7(16)17)5-4-13-6(15)9(10,11)12/h4-5H2,1-3H3,(H,13,15)(H,16,17)/p-1 |
| InChIKey | VIGUYOVXEZFPDM-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate?
The IUPAC name of N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate (CID 53249924) is N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate.
What is the SMILES notation for N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate?
The canonical SMILES for N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate is CC(C)(C)N(CCNC(=O)C(F)(F)F)C(=O)[O-].
What is the InChIKey of N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate?
The InChIKey is VIGUYOVXEZFPDM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H15F3N2O3/c1-8(2,3)14(7(16)17)5-4-13-6(15)9(10,11)12/h4-5H2,1-3H3,(H,13,15)(H,16,17)/p-1.
What are the key properties of N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate?
N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate has a molecular weight of 255.22 g/mol, XLogP of 0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate is sourced from PubChem (CID 53249924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).