About 5-iodo-1-methyltriazole
5-iodo-1-methyltriazole (PubChem CID 53249938) has the molecular formula C3H4IN3
and a molecular weight of 208.99 g/mol. Its IUPAC name is 5-iodo-1-methyltriazole.
Molecular Properties
| Compound Name | 5-iodo-1-methyltriazole |
| PubChem CID | 53249938 |
| Molecular Formula | C3H4IN3 |
| Molecular Weight | 208.99 g/mol |
| Exact Mass | 208.94 |
| IUPAC Name | 5-iodo-1-methyltriazole |
| SMILES | Cn1nncc1I |
| InChI | InChI=1S/C3H4IN3/c1-7-3(4)2-5-6-7/h2H,1H3 |
| InChIKey | RRRKYKMVUDVTHC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.99 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1-methyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1-methyltriazole?
The IUPAC name of 5-iodo-1-methyltriazole (CID 53249938) is 5-iodo-1-methyltriazole.
What is the SMILES notation for 5-iodo-1-methyltriazole?
The canonical SMILES for 5-iodo-1-methyltriazole is Cn1nncc1I.
What is the InChIKey of 5-iodo-1-methyltriazole?
The InChIKey is RRRKYKMVUDVTHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4IN3/c1-7-3(4)2-5-6-7/h2H,1H3.
What are the key properties of 5-iodo-1-methyltriazole?
5-iodo-1-methyltriazole has a molecular weight of 208.99 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1-methyltriazole is sourced from PubChem (CID 53249938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).