C16H15N5O2 — CID 53250247
13-[[(2R)-morpholin-2-yl]methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 53250247) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 13-[[(2R)-morpholin-2-yl]methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 13-[[(2R)-morpholin-2-yl]methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 53250247 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 13-[[(2R)-morpholin-2-yl]methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1nccc(OC[C@H]3CNCCO3)c12 |
| InChI | InChI=1S/C16H15N5O2/c17-6-10-5-12-13(8-20-10)21-16-15(12)14(1-2-19-16)23-9-11-7-18-3-4-22-11/h1-2,5,8,11,18H,3-4,7,9H2,(H,19,21)/t11-/m1/s1 |
| InChIKey | FBTMCEYKHSTFPE-LLVKDONJSA-N |
| XLogP | 1.35 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |