C28H41N3O — CID 53250264
5-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol (PubChem CID 53250264) has the molecular formula C28H41N3O and a molecular weight of 435.66 g/mol. Its IUPAC name is 5-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol.
| Compound Name | 5-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 53250264 |
| Molecular Formula | C28H41N3O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 5-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCN(CCCCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C28H41N3O/c1-27(2)13-14-28(3,4)24-21-22(11-12-23(24)27)25-9-8-10-26(29-25)31-18-16-30(17-19-31)15-6-5-7-20-32/h8-12,21,32H,5-7,13-20H2,1-4H3 |
| InChIKey | QRZHYTLVTGZENC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|