C29H43N3O — CID 53250408
5-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]pentan-1-ol (PubChem CID 53250408) has the molecular formula C29H43N3O and a molecular weight of 449.68 g/mol. Its IUPAC name is 5-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]pentan-1-ol.
| Compound Name | 5-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 53250408 |
| Molecular Formula | C29H43N3O |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | 5-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]pentan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCC(NCCCCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C29H43N3O/c1-28(2)15-16-29(3,4)25-21-22(11-12-24(25)28)26-9-8-10-27(31-26)32-18-13-23(14-19-32)30-17-6-5-7-20-33/h8-12,21,23,30,33H,5-7,13-20H2,1-4H3 |
| InChIKey | QHXFSPKQCSVFEX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|