C21H23N7O — CID 53250548
13-[4-[2-[(2S)-pyrrolidin-2-yl]acetyl]piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 53250548) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 13-[4-[2-[(2S)-pyrrolidin-2-yl]acetyl]piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 13-[4-[2-[(2S)-pyrrolidin-2-yl]acetyl]piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 53250548 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 13-[4-[2-[(2S)-pyrrolidin-2-yl]acetyl]piperazin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1nccc(N3CCN(C(=O)C[C@@H]4CCCN4)CC3)c12 |
| InChI | InChI=1S/C21H23N7O/c22-12-15-10-16-17(13-25-15)26-21-20(16)18(3-5-24-21)27-6-8-28(9-7-27)19(29)11-14-2-1-4-23-14/h3,5,10,13-14,23H,1-2,4,6-9,11H2,(H,24,26)/t14-/m0/s1 |
| InChIKey | UIOOIQMKWKHMEZ-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |