About 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide
3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide (PubChem CID 53250695) has the molecular formula C22H19ClN2O3S2
and a molecular weight of 458.99 g/mol. Its IUPAC name is 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide |
| PubChem CID | 53250695 |
| Molecular Formula | C22H19ClN2O3S2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide |
| SMILES | COc1cccc(-c2sc3nc(C)cc(NS(=O)(=O)c4cccc(Cl)c4)c3c2C)c1 |
| InChI | InChI=1S/C22H19ClN2O3S2/c1-13-10-19(25-30(26,27)18-9-5-7-16(23)12-18)20-14(2)21(29-22(20)24-13)15-6-4-8-17(11-15)28-3/h4-12H,1-3H3,(H,24,25) |
| InChIKey | CSXIZCUHLNOVFA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide?
The IUPAC name of 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide (CID 53250695) is 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide.
What is the SMILES notation for 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide?
The canonical SMILES for 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide is COc1cccc(-c2sc3nc(C)cc(NS(=O)(=O)c4cccc(Cl)c4)c3c2C)c1.
What is the InChIKey of 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide?
The InChIKey is CSXIZCUHLNOVFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN2O3S2/c1-13-10-19(25-30(26,27)18-9-5-7-16(23)12-18)20-14(2)21(29-22(20)24-13)15-6-4-8-17(11-15)28-3/h4-12H,1-3H3,(H,24,25).
What are the key properties of 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide?
3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide has a molecular weight of 458.99 g/mol, XLogP of 6.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2-(3-methoxyphenyl)-3,6-dimethylthieno[2,3-b]pyridin-4-yl]benzenesulfonamide is sourced from PubChem (CID 53250695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).