About 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide
2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide (PubChem CID 53250845) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide |
| PubChem CID | 53250845 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide |
| SMILES | NOCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H11N3O4/c9-15-5-6(12)10-3-4-11-7(13)1-2-8(11)14/h1-2H,3-5,9H2,(H,10,12) |
| InChIKey | OZRBNKSPIYKCCW-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide?
The IUPAC name of 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide (CID 53250845) is 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide.
What is the SMILES notation for 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide?
The canonical SMILES for 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide is NOCC(=O)NCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide?
The InChIKey is OZRBNKSPIYKCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c9-15-5-6(12)10-3-4-11-7(13)1-2-8(11)14/h1-2H,3-5,9H2,(H,10,12).
What are the key properties of 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide?
2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide has a molecular weight of 213.19 g/mol, XLogP of -2.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide is sourced from PubChem (CID 53250845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).