C15H13N5O — CID 53250872
13-[(3R)-3-hydroxypyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 53250872) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 13-[(3R)-3-hydroxypyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 13-[(3R)-3-hydroxypyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 53250872 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 13-[(3R)-3-hydroxypyrrolidin-1-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1nccc(N3CC[C@@H](O)C3)c12 |
| InChI | InChI=1S/C15H13N5O/c16-6-9-5-11-12(7-18-9)19-15-14(11)13(1-3-17-15)20-4-2-10(21)8-20/h1,3,5,7,10,21H,2,4,8H2,(H,17,19)/t10-/m1/s1 |
| InChIKey | IXXFFHGDAFKARL-SNVBAGLBSA-N |
| XLogP | 1.55 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |