About methylseleninylbenzene
methylseleninylbenzene (PubChem CID 5325095) has the molecular formula C7H8OSe
and a molecular weight of 187.10 g/mol. Its IUPAC name is methylseleninylbenzene.
Molecular Properties
| Compound Name | methylseleninylbenzene |
| PubChem CID | 5325095 |
| Molecular Formula | C7H8OSe |
| Molecular Weight | 187.10 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | methylseleninylbenzene |
| SMILES | C[Se](=O)c1ccccc1 |
| InChI | InChI=1S/C7H8OSe/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | YIAYROWKQNSDOV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.10 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methylseleninylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylseleninylbenzene?
The IUPAC name of methylseleninylbenzene (CID 5325095) is methylseleninylbenzene.
What is the SMILES notation for methylseleninylbenzene?
The canonical SMILES for methylseleninylbenzene is C[Se](=O)c1ccccc1.
What is the InChIKey of methylseleninylbenzene?
The InChIKey is YIAYROWKQNSDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OSe/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of methylseleninylbenzene?
methylseleninylbenzene has a molecular weight of 187.10 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylseleninylbenzene is sourced from PubChem (CID 5325095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).