C30H45N3O — CID 53251218
6-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]hexan-1-ol (PubChem CID 53251218) has the molecular formula C30H45N3O and a molecular weight of 463.71 g/mol. Its IUPAC name is 6-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]hexan-1-ol.
| Compound Name | 6-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 53251218 |
| Molecular Formula | C30H45N3O |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.36 |
| IUPAC Name | 6-[[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]amino]hexan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCC(NCCCCCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C30H45N3O/c1-29(2)16-17-30(3,4)26-22-23(12-13-25(26)29)27-10-9-11-28(32-27)33-19-14-24(15-20-33)31-18-7-5-6-8-21-34/h9-13,22,24,31,34H,5-8,14-21H2,1-4H3 |
| InChIKey | PHEXCTVDOXHKNS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|