About 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine
5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine (PubChem CID 53251313) has the molecular formula C18H17N5S
and a molecular weight of 335.44 g/mol. Its IUPAC name is 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine |
| PubChem CID | 53251313 |
| Molecular Formula | C18H17N5S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine |
| SMILES | Cc1cc(C)n2cc(/C=C/c3nc(-c4ccsc4)cn3C)nc2n1 |
| InChI | InChI=1S/C18H17N5S/c1-12-8-13(2)23-9-15(20-18(23)19-12)4-5-17-21-16(10-22(17)3)14-6-7-24-11-14/h4-11H,1-3H3/b5-4+ |
| InChIKey | GBHPQDLYIVDMNV-SNAWJCMRSA-N |
| XLogP | 3.98 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine?
The IUPAC name of 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine (CID 53251313) is 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine?
The canonical SMILES for 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine is Cc1cc(C)n2cc(/C=C/c3nc(-c4ccsc4)cn3C)nc2n1.
What is the InChIKey of 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine?
The InChIKey is GBHPQDLYIVDMNV-SNAWJCMRSA-N. The full InChI is InChI=1S/C18H17N5S/c1-12-8-13(2)23-9-15(20-18(23)19-12)4-5-17-21-16(10-22(17)3)14-6-7-24-11-14/h4-11H,1-3H3/b5-4+.
What are the key properties of 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine?
5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine has a molecular weight of 335.44 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2-[(E)-2-(1-methyl-4-thiophen-3-ylimidazol-2-yl)ethenyl]imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 53251313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).