About 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile
4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile (PubChem CID 53251321) has the molecular formula C23H20N4O2
and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile |
| PubChem CID | 53251321 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cc3c(o2)C(=O)Nc2ccc(N4CCNCC4)cc2C3)cc1 |
| InChI | InChI=1S/C23H20N4O2/c24-14-15-1-3-16(4-2-15)21-13-18-11-17-12-19(27-9-7-25-8-10-27)5-6-20(17)26-23(28)22(18)29-21/h1-6,12-13,25H,7-11H2,(H,26,28) |
| InChIKey | YWYHWXBABMENQU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile?
The IUPAC name of 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile (CID 53251321) is 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile.
What is the SMILES notation for 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile?
The canonical SMILES for 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile is N#Cc1ccc(-c2cc3c(o2)C(=O)Nc2ccc(N4CCNCC4)cc2C3)cc1.
What is the InChIKey of 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile?
The InChIKey is YWYHWXBABMENQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O2/c24-14-15-1-3-16(4-2-15)21-13-18-11-17-12-19(27-9-7-25-8-10-27)5-6-20(17)26-23(28)22(18)29-21/h1-6,12-13,25H,7-11H2,(H,26,28).
What are the key properties of 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile?
4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile has a molecular weight of 384.44 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-oxo-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-2-yl)benzonitrile is sourced from PubChem (CID 53251321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).