C28H40FN3O — CID 53251381
5-[4-[4-fluoro-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol (PubChem CID 53251381) has the molecular formula C28H40FN3O and a molecular weight of 453.65 g/mol. Its IUPAC name is 5-[4-[4-fluoro-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol.
| Compound Name | 5-[4-[4-fluoro-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 53251381 |
| Molecular Formula | C28H40FN3O |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 5-[4-[4-fluoro-6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc(F)cc(N4CCN(CCCCCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C28H40FN3O/c1-27(2)10-11-28(3,4)24-18-21(8-9-23(24)27)25-19-22(29)20-26(30-25)32-15-13-31(14-16-32)12-6-5-7-17-33/h8-9,18-20,33H,5-7,10-17H2,1-4H3 |
| InChIKey | DGUBVJPUZMEXJW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|