C13H16F6O4 — CID 53251468
3-methylbutyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate (PubChem CID 53251468) has the molecular formula C13H16F6O4 and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-methylbutyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate.
| Compound Name | 3-methylbutyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 53251468 |
| Molecular Formula | C13H16F6O4 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-methylbutyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)OC(C(=O)OCCC(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H16F6O4/c1-7(2)5-6-22-10(21)11(12(14,15)16,13(17,18)19)23-9(20)8(3)4/h7H,3,5-6H2,1-2,4H3 |
| InChIKey | UKHLKJVJKACCLI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|