C23H29N5OSSi — CID 53251469
2-[[2-[(E)-2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethenyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 53251469) has the molecular formula C23H29N5OSSi and a molecular weight of 451.67 g/mol. Its IUPAC name is 2-[[2-[(E)-2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethenyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(E)-2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethenyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 53251469 |
| Molecular Formula | C23H29N5OSSi |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[[2-[(E)-2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethenyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(C)n2cc(/C=C/c3nc(-c4cccs4)cn3COCC[Si](C)(C)C)nc2n1 |
| InChI | InChI=1S/C23H29N5OSSi/c1-17-13-18(2)28-14-19(25-23(28)24-17)8-9-22-26-20(21-7-6-11-30-21)15-27(22)16-29-10-12-31(3,4)5/h6-9,11,13-15H,10,12,16H2,1-5H3/b9-8+ |
| InChIKey | CSLSTKUCKXLLPS-CMDGGOBGSA-N |
| XLogP | 5.75 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|