C23H31N5OSSi — CID 53251470
2-[[2-[2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 53251470) has the molecular formula C23H31N5OSSi and a molecular weight of 453.69 g/mol. Its IUPAC name is 2-[[2-[2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 53251470 |
| Molecular Formula | C23H31N5OSSi |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-[[2-[2-(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)ethyl]-4-thiophen-2-ylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(C)n2cc(CCc3nc(-c4cccs4)cn3COCC[Si](C)(C)C)nc2n1 |
| InChI | InChI=1S/C23H31N5OSSi/c1-17-13-18(2)28-14-19(25-23(28)24-17)8-9-22-26-20(21-7-6-11-30-21)15-27(22)16-29-10-12-31(3,4)5/h6-7,11,13-15H,8-10,12,16H2,1-5H3 |
| InChIKey | VVTUCTFPGOVURX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|