C26H26ClN5O — CID 53251592
N-[3-[4-chloro-1-methyl-2-(4-piperazin-1-ylphenyl)pyrrolo[2,3-b]pyridin-3-yl]phenyl]acetamide (PubChem CID 53251592) has the molecular formula C26H26ClN5O and a molecular weight of 459.98 g/mol. Its IUPAC name is N-[3-[4-chloro-1-methyl-2-(4-piperazin-1-ylphenyl)pyrrolo[2,3-b]pyridin-3-yl]phenyl]acetamide.
| Compound Name | N-[3-[4-chloro-1-methyl-2-(4-piperazin-1-ylphenyl)pyrrolo[2,3-b]pyridin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 53251592 |
| Molecular Formula | C26H26ClN5O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[3-[4-chloro-1-methyl-2-(4-piperazin-1-ylphenyl)pyrrolo[2,3-b]pyridin-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2c(-c3ccc(N4CCNCC4)cc3)n(C)c3nccc(Cl)c23)c1 |
| InChI | InChI=1S/C26H26ClN5O/c1-17(33)30-20-5-3-4-19(16-20)23-24-22(27)10-11-29-26(24)31(2)25(23)18-6-8-21(9-7-18)32-14-12-28-13-15-32/h3-11,16,28H,12-15H2,1-2H3,(H,30,33) |
| InChIKey | QOTNJAYIHGWISR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|