C13H8F14O4 — CID 53251616
2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate (PubChem CID 53251616) has the molecular formula C13H8F14O4 and a molecular weight of 494.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 53251616 |
| Molecular Formula | C13H8F14O4 |
| Molecular Weight | 494.18 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)OC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F14O4/c1-4(2)5(28)31-9(12(22,23)24,13(25,26)27)7(29)30-3-8(16,17)11(20,21)10(18,19)6(14)15/h6H,1,3H2,2H3 |
| InChIKey | CVWUOAUNYXMJEQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|