C15H18F6O6 — CID 53251619
3-methylbutyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate (PubChem CID 53251619) has the molecular formula C15H18F6O6 and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-methylbutyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate.
| Compound Name | 3-methylbutyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 53251619 |
| Molecular Formula | C15H18F6O6 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-methylbutyl 3,3,3-trifluoro-2-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC(C(=O)OCCC(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F6O6/c1-8(2)5-6-25-12(24)13(14(16,17)18,15(19,20)21)27-10(22)7-26-11(23)9(3)4/h8H,3,5-7H2,1-2,4H3 |
| InChIKey | NDGUYBLPKNYFBD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|