About 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one
2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one (PubChem CID 53251635) has the molecular formula C22H20ClN3O2
and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one |
| PubChem CID | 53251635 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one |
| SMILES | O=C1Nc2ccc(N3CCNCC3)cc2Cc2cc(-c3ccc(Cl)cc3)oc21 |
| InChI | InChI=1S/C22H20ClN3O2/c23-17-3-1-14(2-4-17)20-13-16-11-15-12-18(26-9-7-24-8-10-26)5-6-19(15)25-22(27)21(16)28-20/h1-6,12-13,24H,7-11H2,(H,25,27) |
| InChIKey | FUZHDIGYHQYSHU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one?
The IUPAC name of 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one (CID 53251635) is 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one.
What is the SMILES notation for 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one?
The canonical SMILES for 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one is O=C1Nc2ccc(N3CCNCC3)cc2Cc2cc(-c3ccc(Cl)cc3)oc21.
What is the InChIKey of 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one?
The InChIKey is FUZHDIGYHQYSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClN3O2/c23-17-3-1-14(2-4-17)20-13-16-11-15-12-18(26-9-7-24-8-10-26)5-6-19(15)25-22(27)21(16)28-20/h1-6,12-13,24H,7-11H2,(H,25,27).
What are the key properties of 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one?
2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one has a molecular weight of 393.87 g/mol, XLogP of 4.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-8-piperazin-1-yl-5,10-dihydrofuro[2,3-c][1]benzazepin-4-one is sourced from PubChem (CID 53251635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).