C14H16FN3O — CID 53251671
(8aS)-8a-(5-amino-2-fluorophenyl)-4,6,7,8-tetrahydro-3,1-benzoxazin-2-amine (PubChem CID 53251671) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is (8aS)-8a-(5-amino-2-fluorophenyl)-4,6,7,8-tetrahydro-3,1-benzoxazin-2-amine.
| Compound Name | (8aS)-8a-(5-amino-2-fluorophenyl)-4,6,7,8-tetrahydro-3,1-benzoxazin-2-amine |
|---|---|
| PubChem CID | 53251671 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (8aS)-8a-(5-amino-2-fluorophenyl)-4,6,7,8-tetrahydro-3,1-benzoxazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc(N)ccc3F)CCCC=C2CO1 |
| InChI | InChI=1S/C14H16FN3O/c15-12-5-4-10(16)7-11(12)14-6-2-1-3-9(14)8-19-13(17)18-14/h3-5,7H,1-2,6,8,16H2,(H2,17,18)/t14-/m0/s1 |
| InChIKey | CEAYRCYYRLRHDZ-AWEZNQCLSA-N |
| XLogP | 2.06 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|